C19H19O8PS — CID 66888259
[2-methoxy-5-[3-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)-3-oxoprop-1-enyl]phenyl] dihydrogen phosphate (PubChem CID 66888259) has the molecular formula C19H19O8PS and a molecular weight of 438.39 g/mol. Its IUPAC name is [2-methoxy-5-[3-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)-3-oxoprop-1-enyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-methoxy-5-[3-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)-3-oxoprop-1-enyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 66888259 |
| Molecular Formula | C19H19O8PS |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | [2-methoxy-5-[3-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)-3-oxoprop-1-enyl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(C=CC(=O)c2cc3c(cc2OC)OCCS3)cc1OP(=O)(O)O |
| InChI | InChI=1S/C19H19O8PS/c1-24-15-6-4-12(9-17(15)27-28(21,22)23)3-5-14(20)13-10-19-18(11-16(13)25-2)26-7-8-29-19/h3-6,9-11H,7-8H2,1-2H3,(H2,21,22,23) |
| InChIKey | PVKSHOZCVWTABM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|