C21H22O6S — CID 50902406
(E)-1-(6-methoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 50902406) has the molecular formula C21H22O6S and a molecular weight of 402.47 g/mol. Its IUPAC name is (E)-1-(6-methoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(6-methoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 50902406 |
| Molecular Formula | C21H22O6S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (E)-1-(6-methoxy-2,3-dihydro-1,4-benzoxathiin-7-yl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(/C=C/C(=O)c2cc3c(cc2OC)SCCO3)c(OC)c1 |
| InChI | InChI=1S/C21H22O6S/c1-23-13-9-17(24-2)14(18(10-13)25-3)5-6-16(22)15-11-20-21(12-19(15)26-4)28-8-7-27-20/h5-6,9-12H,7-8H2,1-4H3/b6-5+ |
| InChIKey | LIBDHXBHNLUPEJ-AATRIKPKSA-N |
| XLogP | 4.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|