C19H18O5S — CID 66871755
3-(3-hydroxy-4-methoxyphenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one (PubChem CID 66871755) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-(3-hydroxy-4-methoxyphenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one.
| Compound Name | 3-(3-hydroxy-4-methoxyphenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66871755 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 3-(3-hydroxy-4-methoxyphenyl)-1-(7-methoxy-2,3-dihydro-1,4-benzoxathiin-6-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc3c(cc2OC)OCCS3)cc1O |
| InChI | InChI=1S/C19H18O5S/c1-22-16-6-4-12(9-15(16)21)3-5-14(20)13-10-19-18(11-17(13)23-2)24-7-8-25-19/h3-6,9-11,21H,7-8H2,1-2H3 |
| InChIKey | FZSPVWWYWKTMCS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|