C17H14O3S — CID 50903027
(E)-1-(5-methoxy-1,3-benzoxathiol-6-yl)-3-phenylprop-2-en-1-one (PubChem CID 50903027) has the molecular formula C17H14O3S and a molecular weight of 298.36 g/mol. Its IUPAC name is (E)-1-(5-methoxy-1,3-benzoxathiol-6-yl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(5-methoxy-1,3-benzoxathiol-6-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 50903027 |
| Molecular Formula | C17H14O3S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (E)-1-(5-methoxy-1,3-benzoxathiol-6-yl)-3-phenylprop-2-en-1-one |
| SMILES | COc1cc2c(cc1C(=O)/C=C/c1ccccc1)OCS2 |
| InChI | InChI=1S/C17H14O3S/c1-19-15-10-17-16(20-11-21-17)9-13(15)14(18)8-7-12-5-3-2-4-6-12/h2-10H,11H2,1H3/b8-7+ |
| InChIKey | IYFZNHCQJXUADW-BQYQJAHWSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|