C24H27NO6S — CID 50903026
(E)-3-(2,5-dimethoxyphenyl)-1-[6-(2-morpholin-4-ylethoxy)-1,3-benzoxathiol-5-yl]prop-2-en-1-one (PubChem CID 50903026) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-1-[6-(2-morpholin-4-ylethoxy)-1,3-benzoxathiol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-1-[6-(2-morpholin-4-ylethoxy)-1,3-benzoxathiol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 50903026 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-1-[6-(2-morpholin-4-ylethoxy)-1,3-benzoxathiol-5-yl]prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)c2cc3c(cc2OCCN2CCOCC2)OCS3)c1 |
| InChI | InChI=1S/C24H27NO6S/c1-27-18-4-6-21(28-2)17(13-18)3-5-20(26)19-14-24-23(31-16-32-24)15-22(19)30-12-9-25-7-10-29-11-8-25/h3-6,13-15H,7-12,16H2,1-2H3/b5-3+ |
| InChIKey | LRNYSHFOBVOLBE-HWKANZROSA-N |
| XLogP | 3.75 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|