C18H16O6S — CID 66871239
1-(5-methoxy-3,3-dioxo-1,3λ6-benzoxathiol-6-yl)-3-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 66871239) has the molecular formula C18H16O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-(5-methoxy-3,3-dioxo-1,3λ6-benzoxathiol-6-yl)-3-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(5-methoxy-3,3-dioxo-1,3λ6-benzoxathiol-6-yl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66871239 |
| Molecular Formula | C18H16O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-(5-methoxy-3,3-dioxo-1,3λ6-benzoxathiol-6-yl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc3c(cc2OC)S(=O)(=O)CO3)cc1 |
| InChI | InChI=1S/C18H16O6S/c1-22-13-6-3-12(4-7-13)5-8-15(19)14-9-17-18(10-16(14)23-2)25(20,21)11-24-17/h3-10H,11H2,1-2H3 |
| InChIKey | HBLUPFDDJDBTOH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|