C20H22O5S — CID 66871728
(E)-1-(2,4-dimethoxy-5-methylsulfanylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 66871728) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is (E)-1-(2,4-dimethoxy-5-methylsulfanylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dimethoxy-5-methylsulfanylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66871728 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (E)-1-(2,4-dimethoxy-5-methylsulfanylphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cc(SC)c(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C20H22O5S/c1-22-16-9-7-13(10-18(16)24-3)6-8-15(21)14-11-20(26-5)19(25-4)12-17(14)23-2/h6-12H,1-5H3/b8-6+ |
| InChIKey | PFRGERWJMASXCG-SOFGYWHQSA-N |
| XLogP | 4.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|