C17H11ClO4S — CID 16724714
6-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-1,3-benzoxathiol-2-one (PubChem CID 16724714) has the molecular formula C17H11ClO4S and a molecular weight of 346.79 g/mol. Its IUPAC name is 6-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 6-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 16724714 |
| Molecular Formula | C17H11ClO4S |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 6-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-5-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cc2sc(=O)oc2cc1C(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C17H11ClO4S/c1-21-14-9-16-15(22-17(20)23-16)8-11(14)13(19)7-6-10-4-2-3-5-12(10)18/h2-9H,1H3/b7-6+ |
| InChIKey | OEYCMDOZKWAJRR-VOTSOKGWSA-N |
| XLogP | 4.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|