C19H17ClFNO3S — CID 8744549
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]prop-2-enamide (PubChem CID 8744549) has the molecular formula C19H17ClFNO3S and a molecular weight of 393.87 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 8744549 |
| Molecular Formula | C19H17ClFNO3S |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)NCCSCc1ccccc1F |
| InChI | InChI=1S/C19H17ClFNO3S/c20-15-9-13(10-17-19(15)25-12-24-17)5-6-18(23)22-7-8-26-11-14-3-1-2-4-16(14)21/h1-6,9-10H,7-8,11-12H2,(H,22,23)/b6-5+ |
| InChIKey | ZHDLHEVOYQEMSE-AATRIKPKSA-N |
| XLogP | 4.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|