C21H22ClNO4 — CID 24678064
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(1-phenylethoxy)propyl]prop-2-enamide (PubChem CID 24678064) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(1-phenylethoxy)propyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(1-phenylethoxy)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 24678064 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[3-(1-phenylethoxy)propyl]prop-2-enamide |
| SMILES | CC(OCCCNC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO4/c1-15(17-6-3-2-4-7-17)25-11-5-10-23-20(24)9-8-16-12-18(22)21-19(13-16)26-14-27-21/h2-4,6-9,12-13,15H,5,10-11,14H2,1H3,(H,23,24)/b9-8+ |
| InChIKey | MYGJLMPQEKDNEO-CMDGGOBGSA-N |
| XLogP | 4.37 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|