C20H21ClN2O3 — CID 24504338
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(dimethylamino)-1-phenylethyl]prop-2-enamide (PubChem CID 24504338) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(dimethylamino)-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(dimethylamino)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 24504338 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(dimethylamino)-1-phenylethyl]prop-2-enamide |
| SMILES | CN(C)CC(NC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-23(2)12-17(15-6-4-3-5-7-15)22-19(24)9-8-14-10-16(21)20-18(11-14)25-13-26-20/h3-11,17H,12-13H2,1-2H3,(H,22,24)/b9-8+ |
| InChIKey | KDDMDUVKHVLYKR-CMDGGOBGSA-N |
| XLogP | 3.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|