C19H17Cl2NO3S — CID 2914040
3-(1,3-benzodioxol-5-yl)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]prop-2-enamide (PubChem CID 2914040) has the molecular formula C19H17Cl2NO3S and a molecular weight of 410.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2914040 |
| Molecular Formula | C19H17Cl2NO3S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NCCSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2NO3S/c20-15-4-3-14(16(21)10-15)11-26-8-7-22-19(23)6-2-13-1-5-17-18(9-13)25-12-24-17/h1-6,9-10H,7-8,11-12H2,(H,22,23) |
| InChIKey | MOVANOMCMSQBSO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|