C19H13Cl2N3O3S2 — CID 44957735
(E)-3-(1,3-benzodioxol-5-yl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 44957735) has the molecular formula C19H13Cl2N3O3S2 and a molecular weight of 466.37 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 44957735 |
| Molecular Formula | C19H13Cl2N3O3S2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 464.98 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)Nc1nnc(SCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C19H13Cl2N3O3S2/c20-13-4-3-12(14(21)8-13)9-28-19-24-23-18(29-19)22-17(25)6-2-11-1-5-15-16(7-11)27-10-26-15/h1-8H,9-10H2,(H,22,23,25)/b6-2+ |
| InChIKey | RDUAYLVKDAWLSY-QHHAFSJGSA-N |
| XLogP | 5.52 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|