C18H18N4O6S2 — CID 71962877
ethyl 2-[[2-[[5-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate (PubChem CID 71962877) has the molecular formula C18H18N4O6S2 and a molecular weight of 450.50 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[[5-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 71962877 |
| Molecular Formula | C18H18N4O6S2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | ethyl 2-[[2-[[5-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CSc1nnc(NC(=O)C=Cc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C18H18N4O6S2/c1-2-26-16(25)8-19-15(24)9-29-18-22-21-17(30-18)20-14(23)6-4-11-3-5-12-13(7-11)28-10-27-12/h3-7H,2,8-10H2,1H3,(H,19,24)(H,20,21,23) |
| InChIKey | UBWRBGPAYCODPS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|