C21H18N4O4S2 — CID 40832868
(E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 40832868) has the molecular formula C21H18N4O4S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 40832868 |
| Molecular Formula | C21H18N4O4S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-methylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)CSc1nnc(NC(=O)/C=C/c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C21H18N4O4S2/c1-13-4-2-3-5-15(13)22-19(27)11-30-21-25-24-20(31-21)23-18(26)9-7-14-6-8-16-17(10-14)29-12-28-16/h2-10H,11-12H2,1H3,(H,22,27)(H,23,24,26)/b9-7+ |
| InChIKey | ALRULFYHNWQBHP-VQHVLOKHSA-N |
| XLogP | 3.96 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|