C22H20N4O5S2 — CID 40832875
(E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 40832875) has the molecular formula C22H20N4O5S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 40832875 |
| Molecular Formula | C22H20N4O5S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[5-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1nnc(NC(=O)/C=C/c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C22H20N4O5S2/c1-2-29-16-6-4-3-5-15(16)23-20(28)12-32-22-26-25-21(33-22)24-19(27)10-8-14-7-9-17-18(11-14)31-13-30-17/h3-11H,2,12-13H2,1H3,(H,23,28)(H,24,25,27)/b10-8+ |
| InChIKey | BFBXPNYKUBRDCI-CSKARUKUSA-N |
| XLogP | 4.05 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|