C19H14ClN3O3S — CID 1320891
3-(1,3-benzodioxol-5-yl)-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 1320891) has the molecular formula C19H14ClN3O3S and a molecular weight of 399.86 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1320891 |
| Molecular Formula | C19H14ClN3O3S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)Nc1nnc(Cc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C19H14ClN3O3S/c20-14-5-1-13(2-6-14)10-18-22-23-19(27-18)21-17(24)8-4-12-3-7-15-16(9-12)26-11-25-15/h1-9H,10-11H2,(H,21,23,24) |
| InChIKey | UWISHKAZDVIPQD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|