C21H19N3O2S — CID 72689195
3-(2,3-dihydro-1-benzofuran-5-yl)-N-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 72689195) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-N-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 72689195 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-N-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(Cc2nnc(NC(=O)C=Cc3ccc4c(c3)CCO4)s2)cc1 |
| InChI | InChI=1S/C21H19N3O2S/c1-14-2-4-16(5-3-14)13-20-23-24-21(27-20)22-19(25)9-7-15-6-8-18-17(12-15)10-11-26-18/h2-9,12H,10-11,13H2,1H3,(H,22,24,25) |
| InChIKey | BMBFXTOARMHFKZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|