C21H18N2O2S — CID 24584279
(E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide (PubChem CID 24584279) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24584279 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]prop-2-enamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)/C=C/c3ccc4c(c3)CCO4)cc2)cs1 |
| InChI | InChI=1S/C21H18N2O2S/c1-14-22-19(13-26-14)16-4-6-18(7-5-16)23-21(24)9-3-15-2-8-20-17(12-15)10-11-25-20/h2-9,12-13H,10-11H2,1H3,(H,23,24)/b9-3+ |
| InChIKey | NRCJFRWPYYVPIP-YCRREMRBSA-N |
| XLogP | 4.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|