C19H17N3OS — CID 28865342
(E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 28865342) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is (E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 28865342 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (E)-N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2ccc(-c3csc(N)n3)cc2)cc1 |
| InChI | InChI=1S/C19H17N3OS/c1-13-2-4-14(5-3-13)6-11-18(23)21-16-9-7-15(8-10-16)17-12-24-19(20)22-17/h2-12H,1H3,(H2,20,22)(H,21,23)/b11-6+ |
| InChIKey | JEBDOKIKIRQMAK-IZZDOVSWSA-N |
| XLogP | 4.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|