C21H19N3O4S — CID 8891258
(E)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 8891258) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is (E)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | (E)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 8891258 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (E)-N-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nnc(Cc3ccccc3)s2)cc2c1OCCO2 |
| InChI | InChI=1S/C21H19N3O4S/c1-26-16-11-15(12-17-20(16)28-10-9-27-17)7-8-18(25)22-21-24-23-19(29-21)13-14-5-3-2-4-6-14/h2-8,11-12H,9-10,13H2,1H3,(H,22,24,25)/b8-7+ |
| InChIKey | VIXVJUMOVLNRLQ-BQYQJAHWSA-N |
| XLogP | 3.56 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|