C20H20ClNO6 — CID 9483458
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide (PubChem CID 9483458) has the molecular formula C20H20ClNO6 and a molecular weight of 405.83 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9483458 |
| Molecular Formula | C20H20ClNO6 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(3,4,5-trimethoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1cc(CNC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C20H20ClNO6/c1-24-15-8-13(9-16(25-2)20(15)26-3)10-22-18(23)5-4-12-6-14(21)19-17(7-12)27-11-28-19/h4-9H,10-11H2,1-3H3,(H,22,23)/b5-4+ |
| InChIKey | NGDAPVJHDIPJAU-SNAWJCMRSA-N |
| XLogP | 3.42 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|