C20H16ClN3O3 — CID 98792626
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(4-pyrazol-1-ylphenyl)methyl]prop-2-enamide (PubChem CID 98792626) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(4-pyrazol-1-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(4-pyrazol-1-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 98792626 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[(4-pyrazol-1-ylphenyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)NCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C20H16ClN3O3/c21-17-10-15(11-18-20(17)27-13-26-18)4-7-19(25)22-12-14-2-5-16(6-3-14)24-9-1-8-23-24/h1-11H,12-13H2,(H,22,25)/b7-4+ |
| InChIKey | JPRVYGGKGLPYIG-QPJJXVBHSA-N |
| XLogP | 3.58 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|