C19H15NO6 — CID 53368559
(3E)-1-(1,3-benzodioxol-5-yl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione (PubChem CID 53368559) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is (3E)-1-(1,3-benzodioxol-5-yl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-1-(1,3-benzodioxol-5-yl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53368559 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (3E)-1-(1,3-benzodioxol-5-yl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
| SMILES | COc1cc(/C=C2\CC(=O)N(c3ccc4c(c3)OCO4)C2=O)ccc1O |
| InChI | InChI=1S/C19H15NO6/c1-24-16-7-11(2-4-14(16)21)6-12-8-18(22)20(19(12)23)13-3-5-15-17(9-13)26-10-25-15/h2-7,9,21H,8,10H2,1H3/b12-6+ |
| InChIKey | CBZUDMNCNFCTGN-WUXMJOGZSA-N |
| XLogP | 2.48 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|