C20H17NO5 — CID 53369154
(3E)-1-(4-acetylphenyl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione (PubChem CID 53369154) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is (3E)-1-(4-acetylphenyl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-1-(4-acetylphenyl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 53369154 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (3E)-1-(4-acetylphenyl)-3-[(4-hydroxy-3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
| SMILES | COc1cc(/C=C2\CC(=O)N(c3ccc(C(C)=O)cc3)C2=O)ccc1O |
| InChI | InChI=1S/C20H17NO5/c1-12(22)14-4-6-16(7-5-14)21-19(24)11-15(20(21)25)9-13-3-8-17(23)18(10-13)26-2/h3-10,23H,11H2,1-2H3/b15-9+ |
| InChIKey | BYACBKRAZMAZCS-OQLLNIDSSA-N |
| XLogP | 2.95 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|