C19H16N2O4 — CID 56763085
N-[4-[(3E)-3-[(3-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 56763085) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[4-[(3E)-3-[(3-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3E)-3-[(3-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 56763085 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[4-[(3E)-3-[(3-hydroxyphenyl)methylidene]-2,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C/C(=C\c3cccc(O)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-12(22)20-15-5-7-16(8-6-15)21-18(24)11-14(19(21)25)9-13-3-2-4-17(23)10-13/h2-10,23H,11H2,1H3,(H,20,22)/b14-9+ |
| InChIKey | DHLGIGQEFKWXSF-NTEUORMPSA-N |
| XLogP | 2.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|