C23H21NO7 — CID 4622236
methyl 4-[(4-hydroxy-3-methoxyphenyl)methylidene]-1-(4-methoxycarbonylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 4622236) has the molecular formula C23H21NO7 and a molecular weight of 423.42 g/mol. Its IUPAC name is methyl 4-[(4-hydroxy-3-methoxyphenyl)methylidene]-1-(4-methoxycarbonylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl 4-[(4-hydroxy-3-methoxyphenyl)methylidene]-1-(4-methoxycarbonylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4622236 |
| Molecular Formula | C23H21NO7 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | methyl 4-[(4-hydroxy-3-methoxyphenyl)methylidene]-1-(4-methoxycarbonylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C(=O)OC)cc2)C(=O)C1=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C23H21NO7/c1-13-20(23(28)31-4)17(11-14-5-10-18(25)19(12-14)29-2)21(26)24(13)16-8-6-15(7-9-16)22(27)30-3/h5-12,25H,1-4H3 |
| InChIKey | SDZUMWRNXVKYBZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|