C21H17FN2O4 — CID 3627780
methyl 1-(4-carbamoylphenyl)-4-[(4-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 3627780) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is methyl 1-(4-carbamoylphenyl)-4-[(4-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl 1-(4-carbamoylphenyl)-4-[(4-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3627780 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | methyl 1-(4-carbamoylphenyl)-4-[(4-fluorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C(N)=O)cc2)C(=O)C1=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2O4/c1-12-18(21(27)28-2)17(11-13-3-7-15(22)8-4-13)20(26)24(12)16-9-5-14(6-10-16)19(23)25/h3-11H,1-2H3,(H2,23,25) |
| InChIKey | QQJZTNPMLCFADN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|