C21H15BrF3NO3 — CID 126387687
methyl (4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate (PubChem CID 126387687) has the molecular formula C21H15BrF3NO3 and a molecular weight of 466.25 g/mol. Its IUPAC name is methyl (4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126387687 |
| Molecular Formula | C21H15BrF3NO3 |
| Molecular Weight | 466.25 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | methyl (4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C(F)(F)F)cc2)C(=O)/C1=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H15BrF3NO3/c1-12-18(20(28)29-2)17(11-13-3-7-15(22)8-4-13)19(27)26(12)16-9-5-14(6-10-16)21(23,24)25/h3-11H,1-2H3/b17-11- |
| InChIKey | RQOYDOODFIHZGA-BOPFTXTBSA-N |
| XLogP | 5.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.25 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|