C24H24BrNO3 — CID 3997089
methyl 4-[(4-bromophenyl)methylidene]-1-(4-butylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 3997089) has the molecular formula C24H24BrNO3 and a molecular weight of 454.36 g/mol. Its IUPAC name is methyl 4-[(4-bromophenyl)methylidene]-1-(4-butylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl 4-[(4-bromophenyl)methylidene]-1-(4-butylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3997089 |
| Molecular Formula | C24H24BrNO3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | methyl 4-[(4-bromophenyl)methylidene]-1-(4-butylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCCCc1ccc(N2C(=O)C(=Cc3ccc(Br)cc3)C(C(=O)OC)=C2C)cc1 |
| InChI | InChI=1S/C24H24BrNO3/c1-4-5-6-17-9-13-20(14-10-17)26-16(2)22(24(28)29-3)21(23(26)27)15-18-7-11-19(25)12-8-18/h7-15H,4-6H2,1-3H3 |
| InChIKey | XKZLYDOBZLDPHR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|