C21H15Cl2NO5 — CID 94847015
4-[(Z)-[1-(3,4-dichlorophenyl)-4-methoxycarbonyl-5-methyl-2-oxopyrrol-3-ylidene]methyl]benzoic acid (PubChem CID 94847015) has the molecular formula C21H15Cl2NO5 and a molecular weight of 432.26 g/mol. Its IUPAC name is 4-[(Z)-[1-(3,4-dichlorophenyl)-4-methoxycarbonyl-5-methyl-2-oxopyrrol-3-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[1-(3,4-dichlorophenyl)-4-methoxycarbonyl-5-methyl-2-oxopyrrol-3-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 94847015 |
| Molecular Formula | C21H15Cl2NO5 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 4-[(Z)-[1-(3,4-dichlorophenyl)-4-methoxycarbonyl-5-methyl-2-oxopyrrol-3-ylidene]methyl]benzoic acid |
| SMILES | COC(=O)C1=C(C)N(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C\c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H15Cl2NO5/c1-11-18(21(28)29-2)15(9-12-3-5-13(6-4-12)20(26)27)19(25)24(11)14-7-8-16(22)17(23)10-14/h3-10H,1-2H3,(H,26,27)/b15-9- |
| InChIKey | BGCGCNAMIQFIRT-DHDCSXOGSA-N |
| XLogP | 4.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|