C22H19Cl2NO4 — CID 6180813
methyl (4Z)-1-(3,4-dichlorophenyl)-4-[(2-ethoxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 6180813) has the molecular formula C22H19Cl2NO4 and a molecular weight of 432.30 g/mol. Its IUPAC name is methyl (4Z)-1-(3,4-dichlorophenyl)-4-[(2-ethoxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(3,4-dichlorophenyl)-4-[(2-ethoxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 6180813 |
| Molecular Formula | C22H19Cl2NO4 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | methyl (4Z)-1-(3,4-dichlorophenyl)-4-[(2-ethoxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOc1ccccc1/C=C1\C(=O)N(c2ccc(Cl)c(Cl)c2)C(C)=C1C(=O)OC |
| InChI | InChI=1S/C22H19Cl2NO4/c1-4-29-19-8-6-5-7-14(19)11-16-20(22(27)28-3)13(2)25(21(16)26)15-9-10-17(23)18(24)12-15/h5-12H,4H2,1-3H3/b16-11- |
| InChIKey | WSRSVJQILNDGQB-WJDWOHSUSA-N |
| XLogP | 5.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|