C20H13Cl4NO3 — CID 126022321
methyl (4Z)-1-(3,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126022321) has the molecular formula C20H13Cl4NO3 and a molecular weight of 457.14 g/mol. Its IUPAC name is methyl (4Z)-1-(3,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-1-(3,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126022321 |
| Molecular Formula | C20H13Cl4NO3 |
| Molecular Weight | 457.14 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | methyl (4Z)-1-(3,5-dichlorophenyl)-4-[(3,4-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cc(Cl)cc(Cl)c2)C(=O)/C1=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H13Cl4NO3/c1-10-18(20(27)28-2)15(5-11-3-4-16(23)17(24)6-11)19(26)25(10)14-8-12(21)7-13(22)9-14/h3-9H,1-2H3/b15-5- |
| InChIKey | DSVIHGKCVSKZDN-WCSRMQSCSA-N |
| XLogP | 6.18 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.14 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|