C21H17BrClNO3 — CID 126024282
methyl (4Z)-4-[(3-bromophenyl)methylidene]-1-(3-chloro-4-methylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126024282) has the molecular formula C21H17BrClNO3 and a molecular weight of 446.73 g/mol. Its IUPAC name is methyl (4Z)-4-[(3-bromophenyl)methylidene]-1-(3-chloro-4-methylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-4-[(3-bromophenyl)methylidene]-1-(3-chloro-4-methylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126024282 |
| Molecular Formula | C21H17BrClNO3 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | methyl (4Z)-4-[(3-bromophenyl)methylidene]-1-(3-chloro-4-methylphenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccc(C)c(Cl)c2)C(=O)/C1=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C21H17BrClNO3/c1-12-7-8-16(11-18(12)23)24-13(2)19(21(26)27-3)17(20(24)25)10-14-5-4-6-15(22)9-14/h4-11H,1-3H3/b17-10- |
| InChIKey | GPGMZIOXLCAKJF-YVLHZVERSA-N |
| XLogP | 5.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|