C21H17Br2NO3 — CID 21211597
ethyl (4Z)-1-(4-bromophenyl)-4-[(3-bromophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 21211597) has the molecular formula C21H17Br2NO3 and a molecular weight of 491.18 g/mol. Its IUPAC name is ethyl (4Z)-1-(4-bromophenyl)-4-[(3-bromophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | ethyl (4Z)-1-(4-bromophenyl)-4-[(3-bromophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 21211597 |
| Molecular Formula | C21H17Br2NO3 |
| Molecular Weight | 491.18 g/mol |
| Exact Mass | 488.96 |
| IUPAC Name | ethyl (4Z)-1-(4-bromophenyl)-4-[(3-bromophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(Br)cc2)C(=O)/C1=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C21H17Br2NO3/c1-3-27-21(26)19-13(2)24(17-9-7-15(22)8-10-17)20(25)18(19)12-14-5-4-6-16(23)11-14/h4-12H,3H2,1-2H3/b18-12- |
| InChIKey | KWBZIHPXXRPXAT-PDGQHHTCSA-N |
| XLogP | 5.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.18 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|