C29H29BrN2O3 — CID 126021519
ethyl (4Z)-1-(4-bromophenyl)-4-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126021519) has the molecular formula C29H29BrN2O3 and a molecular weight of 533.47 g/mol. Its IUPAC name is ethyl (4Z)-1-(4-bromophenyl)-4-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | ethyl (4Z)-1-(4-bromophenyl)-4-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126021519 |
| Molecular Formula | C29H29BrN2O3 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | ethyl (4Z)-1-(4-bromophenyl)-4-[[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(Br)cc2)C(=O)/C1=C\c1cc(C)n(-c2c(C)cccc2C)c1C |
| InChI | InChI=1S/C29H29BrN2O3/c1-7-35-29(34)26-21(6)32(24-13-11-23(30)12-14-24)28(33)25(26)16-22-15-19(4)31(20(22)5)27-17(2)9-8-10-18(27)3/h8-16H,7H2,1-6H3/b25-16- |
| InChIKey | QJFTXDHVXORNKC-XYGWBWBKSA-N |
| XLogP | 6.74 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|