C21H16BrCl2NO3 — CID 126004085
ethyl (4Z)-1-(4-bromophenyl)-4-[(2,6-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 126004085) has the molecular formula C21H16BrCl2NO3 and a molecular weight of 481.17 g/mol. Its IUPAC name is ethyl (4Z)-1-(4-bromophenyl)-4-[(2,6-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | ethyl (4Z)-1-(4-bromophenyl)-4-[(2,6-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126004085 |
| Molecular Formula | C21H16BrCl2NO3 |
| Molecular Weight | 481.17 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | ethyl (4Z)-1-(4-bromophenyl)-4-[(2,6-dichlorophenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(Br)cc2)C(=O)/C1=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H16BrCl2NO3/c1-3-28-21(27)19-12(2)25(14-9-7-13(22)8-10-14)20(26)16(19)11-15-17(23)5-4-6-18(15)24/h4-11H,3H2,1-2H3/b16-11- |
| InChIKey | GPIRZNXJBBEAON-WJDWOHSUSA-N |
| XLogP | 6.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.17 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|