C22H20BrNO5 — CID 3983598
methyl 1-(3-bromophenyl)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 3983598) has the molecular formula C22H20BrNO5 and a molecular weight of 458.31 g/mol. Its IUPAC name is methyl 1-(3-bromophenyl)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl 1-(3-bromophenyl)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3983598 |
| Molecular Formula | C22H20BrNO5 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | methyl 1-(3-bromophenyl)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCOc1cc(C=C2C(=O)N(c3cccc(Br)c3)C(C)=C2C(=O)OC)ccc1O |
| InChI | InChI=1S/C22H20BrNO5/c1-4-29-19-11-14(8-9-18(19)25)10-17-20(22(27)28-3)13(2)24(21(17)26)16-7-5-6-15(23)12-16/h5-12,25H,4H2,1-3H3 |
| InChIKey | GPPCSOUHOUZFKD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|