C19H15NO5 — CID 110458029
(3E)-1-(1,3-benzodioxol-5-yl)-3-[(3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione (PubChem CID 110458029) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is (3E)-1-(1,3-benzodioxol-5-yl)-3-[(3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-1-(1,3-benzodioxol-5-yl)-3-[(3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 110458029 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (3E)-1-(1,3-benzodioxol-5-yl)-3-[(3-methoxyphenyl)methylidene]pyrrolidine-2,5-dione |
| SMILES | COc1cccc(/C=C2\CC(=O)N(c3ccc4c(c3)OCO4)C2=O)c1 |
| InChI | InChI=1S/C19H15NO5/c1-23-15-4-2-3-12(8-15)7-13-9-18(21)20(19(13)22)14-5-6-16-17(10-14)25-11-24-16/h2-8,10H,9,11H2,1H3/b13-7+ |
| InChIKey | DRAJCIVZAMKYAN-NTUHNPAUSA-N |
| XLogP | 2.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|