C27H21NO8 — CID 108666390
(4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108666390) has the molecular formula C27H21NO8 and a molecular weight of 487.46 g/mol. Its IUPAC name is (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108666390 |
| Molecular Formula | C27H21NO8 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C2/C(=C(\O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C27H21NO8/c1-32-18-4-2-3-15(11-18)24-23(25(29)16-5-7-20-21(12-16)36-14-35-20)26(30)27(31)28(24)17-6-8-19-22(13-17)34-10-9-33-19/h2-8,11-13,24,29H,9-10,14H2,1H3/b25-23+ |
| InChIKey | BCIINBDXRHFXSF-WJTDDFOZSA-N |
| XLogP | 3.82 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|