C27H21NO8 — CID 108666651
methyl 3-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108666651) has the molecular formula C27H21NO8 and a molecular weight of 487.46 g/mol. Its IUPAC name is methyl 3-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108666651 |
| Molecular Formula | C27H21NO8 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | methyl 3-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)OCO4)C2c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C27H21NO8/c1-33-19-8-4-5-15(12-19)23-22(24(29)16-9-10-20-21(13-16)36-14-35-20)25(30)26(31)28(23)18-7-3-6-17(11-18)27(32)34-2/h3-13,23,29H,14H2,1-2H3/b24-22- |
| InChIKey | QMVMAMICKIAHED-GYHWCHFESA-N |
| XLogP | 3.84 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|