C26H20N2O8 — CID 108666629
methyl 3-[(3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108666629) has the molecular formula C26H20N2O8 and a molecular weight of 488.45 g/mol. Its IUPAC name is methyl 3-[(3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108666629 |
| Molecular Formula | C26H20N2O8 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | methyl 3-[(3E)-3-[hydroxy-(4-nitrophenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccc([N+](=O)[O-])cc3)C2c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C26H20N2O8/c1-35-20-8-4-5-16(14-20)22-21(23(29)15-9-11-18(12-10-15)28(33)34)24(30)25(31)27(22)19-7-3-6-17(13-19)26(32)36-2/h3-14,22,29H,1-2H3/b23-21+ |
| InChIKey | VVOGDABZOGIDDH-XTQSDGFTSA-N |
| XLogP | 4.02 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|