C29H21NO5 — CID 108598651
methyl 3-[(4Z)-4-[hydroxy(naphthalen-2-yl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate (PubChem CID 108598651) has the molecular formula C29H21NO5 and a molecular weight of 463.49 g/mol. Its IUPAC name is methyl 3-[(4Z)-4-[hydroxy(naphthalen-2-yl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(4Z)-4-[hydroxy(naphthalen-2-yl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108598651 |
| Molecular Formula | C29H21NO5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | methyl 3-[(4Z)-4-[hydroxy(naphthalen-2-yl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4ccccc4c3)C2c2ccccc2)c1 |
| InChI | InChI=1S/C29H21NO5/c1-35-29(34)22-12-7-13-23(17-22)30-25(19-9-3-2-4-10-19)24(27(32)28(30)33)26(31)21-15-14-18-8-5-6-11-20(18)16-21/h2-17,25,31H,1H3/b26-24- |
| InChIKey | PCNBRRIDAHRNJP-LCUIJRPUSA-N |
| XLogP | 5.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|