C26H19Cl2NO6 — CID 108665689
methyl 3-[(3E)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108665689) has the molecular formula C26H19Cl2NO6 and a molecular weight of 512.35 g/mol. Its IUPAC name is methyl 3-[(3E)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(3E)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108665689 |
| Molecular Formula | C26H19Cl2NO6 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | methyl 3-[(3E)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Cl)c(Cl)c3)C2c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C26H19Cl2NO6/c1-34-18-9-6-14(7-10-18)22-21(23(30)15-8-11-19(27)20(28)13-15)24(31)25(32)29(22)17-5-3-4-16(12-17)26(33)35-2/h3-13,22,30H,1-2H3/b23-21+ |
| InChIKey | ZVFYJDBXJXVDJP-XTQSDGFTSA-N |
| XLogP | 5.41 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|