C28H25NO8 — CID 108666358
(4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108666358) has the molecular formula C28H25NO8 and a molecular weight of 503.51 g/mol. Its IUPAC name is (4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108666358 |
| Molecular Formula | C28H25NO8 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C2/C(=C(\O)c3ccc(OC)cc3OC)C(=O)C(=O)N2c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C28H25NO8/c1-33-18-6-4-5-16(13-18)25-24(26(30)20-9-8-19(34-2)15-22(20)35-3)27(31)28(32)29(25)17-7-10-21-23(14-17)37-12-11-36-21/h4-10,13-15,25,30H,11-12H2,1-3H3/b26-24+ |
| InChIKey | UEOBOANTOKSXOU-SHHOIMCASA-N |
| XLogP | 4.11 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|