C29H28N2O7 — CID 108705774
(4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione (PubChem CID 108705774) has the molecular formula C29H28N2O7 and a molecular weight of 516.55 g/mol. Its IUPAC name is (4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108705774 |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | (4E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc4c(c3)OCCO4)C2c2ccc(N(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C29H28N2O7/c1-30(2)18-7-5-17(6-8-18)26-25(27(32)21-11-10-20(35-3)16-23(21)36-4)28(33)29(34)31(26)19-9-12-22-24(15-19)38-14-13-37-22/h5-12,15-16,26,32H,13-14H2,1-4H3/b27-25+ |
| InChIKey | XMJZCPOUUYOSFX-IMVLJIQESA-N |
| XLogP | 4.17 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|