C31H35N3O5 — CID 108705600
(4Z)-1-[4-(diethylamino)phenyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione (PubChem CID 108705600) has the molecular formula C31H35N3O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is (4Z)-1-[4-(diethylamino)phenyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[4-(diethylamino)phenyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108705600 |
| Molecular Formula | C31H35N3O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (4Z)-1-[4-(diethylamino)phenyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(OC)cc3OC)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H35N3O5/c1-7-33(8-2)22-13-15-23(16-14-22)34-28(20-9-11-21(12-10-20)32(3)4)27(30(36)31(34)37)29(35)25-18-17-24(38-5)19-26(25)39-6/h9-19,28,35H,7-8H2,1-6H3/b29-27- |
| InChIKey | FNXSVWLERAPWJC-OHYPFYFLSA-N |
| XLogP | 5.24 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|