C31H22FNO6 — CID 108711786
(4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108711786) has the molecular formula C31H22FNO6 and a molecular weight of 523.52 g/mol. Its IUPAC name is (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108711786 |
| Molecular Formula | C31H22FNO6 |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4-fluorophenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(F)cc2)C(c2cccc(Oc3ccccc3)c2)/C1=C(/O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C31H22FNO6/c32-21-10-12-22(13-11-21)33-28(19-5-4-8-24(17-19)39-23-6-2-1-3-7-23)27(30(35)31(33)36)29(34)20-9-14-25-26(18-20)38-16-15-37-25/h1-14,17-18,28,34H,15-16H2/b29-27- |
| InChIKey | IYMROOPGOKOPDY-OHYPFYFLSA-N |
| XLogP | 6.02 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|