C15H17Cl2NO — CID 110538697
(3E)-3-[(2,6-dichlorophenyl)methylidene]-1-propylpiperidin-4-one (PubChem CID 110538697) has the molecular formula C15H17Cl2NO and a molecular weight of 298.21 g/mol. Its IUPAC name is (3E)-3-[(2,6-dichlorophenyl)methylidene]-1-propylpiperidin-4-one.
| Compound Name | (3E)-3-[(2,6-dichlorophenyl)methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 110538697 |
| Molecular Formula | C15H17Cl2NO |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (3E)-3-[(2,6-dichlorophenyl)methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1CCC(=O)/C(=C/c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C15H17Cl2NO/c1-2-7-18-8-6-15(19)11(10-18)9-12-13(16)4-3-5-14(12)17/h3-5,9H,2,6-8,10H2,1H3/b11-9+ |
| InChIKey | AOGXCENNVARKHZ-PKNBQFBNSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|