C19H27NO — CID 110539265
(3E)-3-[(4-tert-butylphenyl)methylidene]-1-propylpiperidin-4-one (PubChem CID 110539265) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (3E)-3-[(4-tert-butylphenyl)methylidene]-1-propylpiperidin-4-one.
| Compound Name | (3E)-3-[(4-tert-butylphenyl)methylidene]-1-propylpiperidin-4-one |
|---|---|
| PubChem CID | 110539265 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (3E)-3-[(4-tert-butylphenyl)methylidene]-1-propylpiperidin-4-one |
| SMILES | CCCN1CCC(=O)/C(=C/c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C19H27NO/c1-5-11-20-12-10-18(21)16(14-20)13-15-6-8-17(9-7-15)19(2,3)4/h6-9,13H,5,10-12,14H2,1-4H3/b16-13+ |
| InChIKey | JNHANGRHCBNESJ-DTQAZKPQSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|